EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H6O2S |
| Net Charge | 0 |
| Average Mass | 154.190 |
| Monoisotopic Mass | 154.00885 |
| SMILES | O=C(O)c1ccccc1S |
| InChI | InChI=1S/C7H6O2S/c8-7(9)5-3-1-2-4-6(5)10/h1-4,10H,(H,8,9) |
| InChIKey | NBOMNTLFRHMDEZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. |
| Applications: | non-narcotic analgesic A drug that has principally analgesic, antipyretic and anti-inflammatory actions. Non-narcotic analgesics do not bind to opioid receptors. antipyretic A drug that prevents or reduces fever by lowering the body temperature from a raised state. An antipyretic will not affect the normal body temperature if one does not have fever. Antipyretics cause the hypothalamus to override an interleukin-induced increase in temperature. The body will then work to lower the temperature and the result is a reduction in fever. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiosalicylic acid (CHEBI:59124) has role antipyretic (CHEBI:35493) |
| thiosalicylic acid (CHEBI:59124) has role non-narcotic analgesic (CHEBI:35481) |
| thiosalicylic acid (CHEBI:59124) is a sulfanylbenzoic acid (CHEBI:59126) |
| thiosalicylic acid (CHEBI:59124) is conjugate acid of thiosalicylate(1−) (CHEBI:59127) |
| Incoming Relation(s) |
| thiosalicylate(1−) (CHEBI:59127) is conjugate base of thiosalicylic acid (CHEBI:59124) |
| IUPAC Name |
|---|
| 2-sulfanylbenzoic acid |
| Synonyms | Source |
|---|---|
| 2-Carboxythiophenol | ChemIDplus |
| 2-Mercaptobenzoic acid | ChemIDplus |
| 2-Sulfanylbenzoic acid | ChemIDplus |
| 2-Thiosalicylic acid | ChemIDplus |
| o-Benzoic acid thiol | ChemIDplus |
| o-Carboxythiophenol | ChemIDplus |
| Citations |
|---|