EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H23NO2 |
| Net Charge | 0 |
| Average Mass | 237.343 |
| Monoisotopic Mass | 237.17288 |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n(O)c(=O)c1 |
| InChI | InChI=1S/C14H23NO2/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5/h6,8,11,17H,7,9H2,1-5H3 |
| InChIKey | OIQJEQLSYJSNDS-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | antiseborrheic A drug or agent applied to the skin to control seborrhea or seborrheic dermatitis. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piroctone (CHEBI:59009) has role antiseborrheic (CHEBI:59010) |
| piroctone (CHEBI:59009) is a cyclic hydroxamic acid (CHEBI:23445) |
| piroctone (CHEBI:59009) is a hydroxypyridone antifungal drug (CHEBI:87130) |
| piroctone (CHEBI:59009) is a pyridone (CHEBI:38183) |
| Incoming Relation(s) |
| piroctone olamine (CHEBI:59008) has part piroctone (CHEBI:59009) |
| IUPAC Name |
|---|
| 1-hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)pyridin-2(1H)-one |
| INNs | Source |
|---|---|
| piroctona | ChemIDplus |
| piroctone | WHO MedNet |
| piroctone | KEGG DRUG |
| piroctonum | ChemIDplus |
| Synonym | Source |
|---|---|
| 1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2(1H)-pyridone | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1531677 | Reaxys |
| CAS:50650-76-5 | KEGG DRUG |
| CAS:50650-76-5 | ChemIDplus |