EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22NO2.C2H8NO |
| Net Charge | 0 |
| Average Mass | 298.427 |
| Monoisotopic Mass | 298.22564 |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n([O-])c(=O)c1.[NH3+]CCO |
| InChI | InChI=1S/C14H22NO2.C2H7NO/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5;3-1-2-4/h6,8,11H,7,9H2,1-5H3;4H,1-3H2/q-1;/p+1 |
| InChIKey | GHPFVSRTGHIHCD-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | antiseborrheic A drug or agent applied to the skin to control seborrhea or seborrheic dermatitis. drug allergen Any drug which causes the onset of an allergic reaction. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piroctone olamine (CHEBI:59008) has part ethanolaminium(1+) (CHEBI:57603) |
| piroctone olamine (CHEBI:59008) has part piroctone (CHEBI:59009) |
| piroctone olamine (CHEBI:59008) has role antiseborrheic (CHEBI:59010) |
| piroctone olamine (CHEBI:59008) has role drug allergen (CHEBI:88188) |
| piroctone olamine (CHEBI:59008) is a hydroxypyridone antifungal drug (CHEBI:87130) |
| piroctone olamine (CHEBI:59008) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| 2-hydroxyethanaminium 4-methyl-2-oxo-6-(2,4,4-trimethylpentyl)pyridin-1(2H)-olate |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2-(1H)pyridinone 2-aminoethanol salt | ChemIDplus |
| Piroctone ethanolamine salt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05505 | KEGG DRUG |
| Piroctone_olamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7503297 | Reaxys |
| CAS:68890-66-4 | KEGG DRUG |
| CAS:68890-66-4 | ChemIDplus |
| Citations |
|---|