EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H22NO2.C2H8NO |
| Net Charge | 0 |
| Average Mass | 298.427 |
| Monoisotopic Mass | 298.22564 |
| SMILES | Cc1cc(CC(C)CC(C)(C)C)n([O-])c(=O)c1.[NH3+]CCO |
| InChI | InChI=1S/C14H22NO2.C2H7NO/c1-10-6-12(15(17)13(16)8-10)7-11(2)9-14(3,4)5;3-1-2-4/h6,8,11H,7,9H2,1-5H3;4H,1-3H2/q-1;/p+1 |
| InChIKey | GHPFVSRTGHIHCD-UHFFFAOYSA-O |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | drug allergen Any drug which causes the onset of an allergic reaction. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Applications: | drug allergen Any drug which causes the onset of an allergic reaction. antiseborrheic A drug or agent applied to the skin to control seborrhea or seborrheic dermatitis. antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| piroctone olamine (CHEBI:59008) has part ethanolaminium(1+) (CHEBI:57603) |
| piroctone olamine (CHEBI:59008) has part piroctone (CHEBI:59009) |
| piroctone olamine (CHEBI:59008) has role antiseborrheic (CHEBI:59010) |
| piroctone olamine (CHEBI:59008) has role drug allergen (CHEBI:88188) |
| piroctone olamine (CHEBI:59008) is a hydroxypyridone antifungal drug (CHEBI:87130) |
| piroctone olamine (CHEBI:59008) is a organoammonium salt (CHEBI:46850) |
| IUPAC Name |
|---|
| 2-hydroxyethanaminium 4-methyl-2-oxo-6-(2,4,4-trimethylpentyl)pyridin-1(2H)-olate |
| Synonyms | Source |
|---|---|
| 1-Hydroxy-4-methyl-6-(2,4,4-trimethylpentyl)-2-(1H)pyridinone 2-aminoethanol salt | ChemIDplus |
| Piroctone ethanolamine salt | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D05505 | KEGG DRUG |
| Piroctone_olamine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7503297 | Reaxys |
| CAS:68890-66-4 | KEGG DRUG |
| CAS:68890-66-4 | ChemIDplus |
| Citations |
|---|