EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O5S |
| Net Charge | 0 |
| Average Mass | 312.347 |
| Monoisotopic Mass | 312.07799 |
| SMILES | [H][C@]12CC(S/C=C/NC(C)=O)=C(C(=O)O)N1C(=O)[C@]2([H])[C@H](C)O |
| InChI | InChI=1S/C13H16N2O5S/c1-6(16)10-8-5-9(21-4-3-14-7(2)17)11(13(19)20)15(8)12(10)18/h3-4,6,8,10,16H,5H2,1-2H3,(H,14,17)(H,19,20)/b4-3+/t6-,8+,10+/m0/s1 |
| InChIKey | PRPNUZWHFGSGRV-RZFSBTTISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Applications: | antibacterial drug A drug used to treat or prevent bacterial infections. drug allergen Any drug which causes the onset of an allergic reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| carbapenem MM22383 (CHEBI:58998) has role antibacterial drug (CHEBI:36047) |
| carbapenem MM22383 (CHEBI:58998) has role drug allergen (CHEBI:88188) |
| carbapenem MM22383 (CHEBI:58998) is a carbapenemcarboxylic acid (CHEBI:46634) |
| carbapenem MM22383 (CHEBI:58998) is a α,β-unsaturated monocarboxylic acid (CHEBI:79020) |
| IUPAC Name |
|---|
| (5R,6S)-2-{[(E)-2-acetamidovinyl]sulfanyl}-6-[(1S)-1-hydroxyethyl]-2,3-didehydro-1-carbapenam-3-carboxylic acid |
| Synonyms | Source |
|---|---|
| (5R,6S)-3-{[(E)-2-acetamidovinyl]sulfanyl}-6-[(1S)-1-hydroxyethyl]-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylic acid | IUPAC |
| MM22383 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C17398 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:497581 | Beilstein |
| CAS:65322-98-7 | KEGG COMPOUND |
| Citations |
|---|