EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15IN2O4S |
| Net Charge | 0 |
| Average Mass | 434.255 |
| Monoisotopic Mass | 433.97973 |
| SMILES | O=C(CI)NCCNc1cccc2c(S(=O)(=O)O)cccc12 |
| InChI | InChI=1S/C14H15IN2O4S/c15-9-14(18)17-8-7-16-12-5-1-4-11-10(12)3-2-6-13(11)22(19,20)21/h1-6,16H,7-9H2,(H,17,18)(H,19,20,21) |
| InChIKey | ZMERMCRYYFRELX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | fluorescent probe A role played by a fluorescent molecular entity used to study the microscopic environment by fluorescence spectroscopy. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-{[2-(iodoacetamido)ethyl]amino}naphthalene-1-sulfonic acid (CHEBI:58984) has role fluorescent probe (CHEBI:39442) |
| 5-{[2-(iodoacetamido)ethyl]amino}naphthalene-1-sulfonic acid (CHEBI:58984) is a aminonaphthalenesulfonic acid (CHEBI:38210) |
| IUPAC Name |
|---|
| 5-{[2-(iodoacetamido)ethyl]amino}naphthalene-1-sulfonic acid |
| Synonyms | Source |
|---|---|
| 1,5-I-Aedans | ChemIDplus |
| N-(Iodoacetylaminoethyl)-5-naphthylamine-1-sulfonic acid | ChemIDplus |
| N-iodoacetyl-N'-(5-sulfo-1-naphthyl)ethylenediamine | ChEBI |
| IAEDANS | ChEBI |
| I-AED | ChEBI |
| N-iodoacetyl-N'-(5-sulfonic-1-napthyl)ethylene-diamine | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3004454 | Reaxys |
| CAS:36930-63-9 | ChemIDplus |
| Citations |
|---|