EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N3O6S2 |
| Net Charge | -1 |
| Average Mass | 338.387 |
| Monoisotopic Mass | 338.04860 |
| SMILES | [NH3+][C@@H](CCC(=O)N[C@@H](CSS)C(=O)NCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C10H17N3O6S2/c11-5(10(18)19)1-2-7(14)13-6(4-21-20)9(17)12-3-8(15)16/h5-6,20H,1-4,11H2,(H,12,17)(H,13,14)(H,15,16)(H,18,19)/p-1/t5-,6-/m0/s1 |
| InChIKey | QBOLVLBSUGJHGB-WDSKDSINSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| S-sulfanylglutathionate(1−) (CHEBI:58905) is a α-amino-acid anion (CHEBI:33558) |
| S-sulfanylglutathionate(1−) (CHEBI:58905) is conjugate base of S-sulfanylglutathione (CHEBI:52857) |
| Incoming Relation(s) |
| S-sulfanylglutathione (CHEBI:52857) is conjugate acid of S-sulfanylglutathionate(1−) (CHEBI:58905) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-({(2R)-1-[(carboxylatomethyl)amino]-3-disulfanyl-1-oxopropan-2-yl}amino)-5-oxopentanoate |
| Synonym | Source |
|---|---|
| (2S)-2-azaniumyl-4-{[(1R)-1-[(carboxylatomethyl)carbamoyl]-2-disulfanylethyl]carbamoyl}butanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| S-sulfanylglutathione | UniProt |