EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O17P2 |
| Net Charge | -2 |
| Average Mass | 564.286 |
| Monoisotopic Mass | 564.04047 |
| SMILES | O=c1ccn([C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])O[C@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)[C@@H](O)[C@H]2O)c(=O)n1 |
| InChI | InChI=1S/C15H24N2O17P2/c18-3-5-8(20)10(22)12(24)14(32-5)33-36(28,29)34-35(26,27)30-4-6-9(21)11(23)13(31-6)17-2-1-7(19)16-15(17)25/h1-2,5-6,8-14,18,20-24H,3-4H2,(H,26,27)(H,28,29)(H,16,19,25)/p-2/t5-,6-,8-,9-,10+,11-,12-,13-,14-/m1/s1 |
| InChIKey | HSCJRCZFDFQWRP-JZMIEXBBSA-L |
| Roles Classification |
|---|
| Biological Roles: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| UDP-α-D-glucose(2−) (CHEBI:58885) is a NDP-α-D-glucose(2−) (CHEBI:76533) |
| UDP-α-D-glucose(2−) (CHEBI:58885) is a nucleotide-sugar oxoanion (CHEBI:59737) |
| UDP-α-D-glucose(2−) (CHEBI:58885) is a ribonucleoside 5'-diphosphate-α-D-glucose(2−) (CHEBI:138068) |
| UDP-α-D-glucose(2−) (CHEBI:58885) is a UDP-D-glucose(2−) (CHEBI:58367) |
| UDP-α-D-glucose(2−) (CHEBI:58885) is a UDP-monosaccharide(2−) (CHEBI:140359) |
| UDP-α-D-glucose(2−) (CHEBI:58885) is conjugate base of UDP-α-D-glucose (CHEBI:46229) |
| Incoming Relation(s) |
| UDP-α-D-glucose (CHEBI:46229) is conjugate acid of UDP-α-D-glucose(2−) (CHEBI:58885) |
| IUPAC Name |
|---|
| uridine 5'-[3-α-D-glucopyranosyl diphosphate] |
| UniProt Name | Source |
|---|---|
| UDP-α-D-glucose | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3827329 | Beilstein |