EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H7O7 |
| Net Charge | -3 |
| Average Mass | 203.126 |
| Monoisotopic Mass | 203.02082 |
| SMILES | O=C([O-])CC[C@@](O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H10O7/c8-4(9)1-2-7(14,6(12)13)3-5(10)11/h14H,1-3H2,(H,8,9)(H,10,11)(H,12,13)/p-3/t7-/m1/s1 |
| InChIKey | XKJVEVRQMLKSMO-SSDOTTSWSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-homocitrate(3−) (CHEBI:58884) is a tricarboxylic acid trianion (CHEBI:27092) |
| (2R)-homocitrate(3−) (CHEBI:58884) is conjugate base of (2R)-homocitric acid (CHEBI:52222) |
| Incoming Relation(s) |
| (2R)-homocitric acid (CHEBI:52222) is conjugate acid of (2R)-homocitrate(3−) (CHEBI:58884) |
| IUPAC Name |
|---|
| (2R)-2-hydroxybutane-1,2,4-tricarboxylate |
| Synonym | Source |
|---|---|
| (R)-2-hydroxybutane-1,2,4-tricarboxylate | ChEBI |
| UniProt Name | Source |
|---|---|
| (2R)-homocitrate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Gmelin:1425159 | Gmelin |