EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H10O7 |
| Net Charge | 0 |
| Average Mass | 206.150 |
| Monoisotopic Mass | 206.04265 |
| SMILES | O=C(O)CC[C@@](O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C7H10O7/c8-4(9)1-2-7(14,6(12)13)3-5(10)11/h14H,1-3H2,(H,8,9)(H,10,11)(H,12,13)/t7-/m1/s1 |
| InChIKey | XKJVEVRQMLKSMO-SSDOTTSWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2R)-homocitric acid (CHEBI:52222) is a homocitric acid (CHEBI:17852) |
| (2R)-homocitric acid (CHEBI:52222) is conjugate acid of (2R)-homocitrate(3−) (CHEBI:58884) |
| (2R)-homocitric acid (CHEBI:52222) is enantiomer of (2S)-homocitric acid (CHEBI:143966) |
| Incoming Relation(s) |
| (2R)-homocitrate(3−) (CHEBI:58884) is conjugate base of (2R)-homocitric acid (CHEBI:52222) |
| (2S)-homocitric acid (CHEBI:143966) is enantiomer of (2R)-homocitric acid (CHEBI:52222) |
| IUPAC Name |
|---|
| (2R)-2-hydroxybutane-1,2,4-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| 3-Hydroxy-3-carboxyadipic acid | KEGG COMPOUND |
| Homocitrate | KEGG COMPOUND |
| Homocitric acid | KEGG COMPOUND |
| (R)-2-Hydroxy-1,2,4-butanetricarboxylic acid | KEGG COMPOUND |
| (R)-2-hydroxybutane-1,2,4-tricarboxylic acid | SUBMITTER |
| (R)-homocitric acid | SUBMITTER |