EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H7O6P |
| Net Charge | -2 |
| Average Mass | 182.068 |
| Monoisotopic Mass | 181.99912 |
| SMILES | CC(=O)[C@@H](O)COP(=O)([O-])[O-] |
| InChI | InChI=1S/C4H9O6P/c1-3(5)4(6)2-10-11(7,8)9/h4,6H,2H2,1H3,(H2,7,8,9)/p-2/t4-/m0/s1 |
| InChIKey | OKYHYXLCTGGOLM-BYPYZUCNSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-hydroxy-3-oxobutyl phosphate(2−) (CHEBI:58830) is a organophosphate oxoanion (CHEBI:58945) |
| (2S)-2-hydroxy-3-oxobutyl phosphate(2−) (CHEBI:58830) is conjugate base of (2S)-2-hydroxy-3-oxobutyl phosphate (CHEBI:50608) |
| Incoming Relation(s) |
| (2S)-2-hydroxy-3-oxobutyl phosphate (CHEBI:50608) is conjugate acid of (2S)-2-hydroxy-3-oxobutyl phosphate(2−) (CHEBI:58830) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3-oxobutyl phosphate |
| Synonyms | Source |
|---|---|
| 1-deoxy-L-glycero-tetrulose 4-phosphate(2−) | ChEBI |
| (3S)-3-hydroxy-4-(phosphonatooxy)butan-2-one | ChEBI |
| UniProt Name | Source |
|---|---|
| (2S)-2-hydroxy-3-oxobutyl phosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:11408093 | Beilstein |