EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H9O6P |
| Net Charge | 0 |
| Average Mass | 184.084 |
| Monoisotopic Mass | 184.01367 |
| SMILES | CC(=O)[C@@H](O)COP(=O)(O)O |
| InChI | InChI=1S/C4H9O6P/c1-3(5)4(6)2-10-11(7,8)9/h4,6H,2H2,1H3,(H2,7,8,9)/t4-/m0/s1 |
| InChIKey | OKYHYXLCTGGOLM-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (2S)-2-hydroxy-3-oxobutyl phosphate (CHEBI:50608) is a 2-hydroxy-3-oxobutyl phosphate (CHEBI:50606) |
| (2S)-2-hydroxy-3-oxobutyl phosphate (CHEBI:50608) is conjugate acid of (2S)-2-hydroxy-3-oxobutyl phosphate(2−) (CHEBI:58830) |
| Incoming Relation(s) |
| (2S)-2-hydroxy-3-oxobutyl phosphate(2−) (CHEBI:58830) is conjugate base of (2S)-2-hydroxy-3-oxobutyl phosphate (CHEBI:50608) |
| IUPAC Name |
|---|
| (2S)-2-hydroxy-3-oxobutyl dihydrogen phosphate |
| Synonyms | Source |
|---|---|
| 3,4-Dihydroxy-2-butanone-4-phosphate | ChemIDplus |
| 3,4-Dhbp | ChemIDplus |
| (S)-3-hydroxy-4-(phosphonooxy)-2-butanone | ChemIDplus |
| (3S)-3-hydroxy-4-(phosphonooxy)butan-2-one | IUPAC |
| L-3,4-dihydroxybutan-2-one 4-phosphate | IUBMB |
| 1-deoxy-L-glycero-tetrulose 4-phosphate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8764138 | Beilstein |
| CAS:130971-02-7 | ChemIDplus |