EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H25N2.Cl |
| Net Charge | 0 |
| Average Mass | 316.876 |
| Monoisotopic Mass | 316.17063 |
| SMILES | [Cl-].[H][N+](C)(C)CCCN1c2ccccc2CCc2ccccc21 |
| InChI | InChI=1S/C19H24N2.ClH/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21;/h3-6,8-11H,7,12-15H2,1-2H3;1H |
| InChIKey | XZZXIYZZBJDEEP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| imipramine hydrochloride (CHEBI:5882) has part imipramine (CHEBI:47499) |
| imipramine hydrochloride (CHEBI:5882) has role antidepressant (CHEBI:35469) |
| imipramine hydrochloride (CHEBI:5882) is a hydrochloride (CHEBI:36807) |
| IUPAC Names |
|---|
| 3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride |
| 3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride |
| Synonyms | Source |
|---|---|
| Imipramine hydrochloride | KEGG COMPOUND |
| Antideprin hydrochloride | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tofranil | ChemIDplus |