EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H12O5S |
| Net Charge | -2 |
| Average Mass | 220.246 |
| Monoisotopic Mass | 220.04164 |
| SMILES | CSCCCC(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C8H14O5S/c1-14-4-2-3-8(13,7(11)12)5-6(9)10/h13H,2-5H2,1H3,(H,9,10)(H,11,12)/p-2 |
| InChIKey | WLOKFRZXOVZGIN-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(3-methylthiopropyl)malate(2−) (CHEBI:58817) is a 2-(ω-methylthio)alkylmalate(2−) (CHEBI:133494) |
| 2-(3-methylthiopropyl)malate(2−) (CHEBI:58817) is conjugate base of 2-(3-methylthiopropyl)malic acid (CHEBI:50262) |
| Incoming Relation(s) |
| 2-(3-methylthiopropyl)malic acid (CHEBI:50262) is conjugate acid of 2-(3-methylthiopropyl)malate(2−) (CHEBI:58817) |
| IUPAC Name |
|---|
| 2-hydroxy-2-[3-(methylsulfanyl)propyl]butanedioate |
| Synonym | Source |
|---|---|
| 2-hydroxy-2-[3-(methylsulfanyl)propyl]succinate | ChEBI |
| UniProt Name | Source |
|---|---|
| 2-(3-methylsulfanyl)propylmalate | UniProt |