EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)n.C6H8O5S |
| Net Charge | -2 |
| Average Mass | 206.219 |
| Monoisotopic Mass | 206.02599 |
| SMILES | CSCCC(O)(CC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C7H12O5S/c1-13-3-2-7(12,6(10)11)4-5(8)9/h12H,2-4H2,1H3,(H,8,9)(H,10,11)/p-2 |
| InChIKey | FZNWJRXTACKOPU-UHFFFAOYSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-(ω-methylthio)alkylmalate(2−) (CHEBI:133494) is a dicarboxylic acid dianion (CHEBI:28965) |
| 2-(ω-methylthio)alkylmalate(2−) (CHEBI:133494) is conjugate base of 2-(ω-methylthio)alkylmalic acid (CHEBI:134530) |
| Incoming Relation(s) |
| 2-(2-methylthioethyl)malate(2−) (CHEBI:58816) is a 2-(ω-methylthio)alkylmalate(2−) (CHEBI:133494) |
| 2-(3-methylthiopropyl)malate(2−) (CHEBI:58817) is a 2-(ω-methylthio)alkylmalate(2−) (CHEBI:133494) |
| 2-(ω-methylthio)alkylmalic acid (CHEBI:134530) is conjugate acid of 2-(ω-methylthio)alkylmalate(2−) (CHEBI:133494) |
| UniProt Name | Source |
|---|---|
| a 2-ω-(methylsulfanyl)alkylmalate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19482 | MetaCyc |
| Citations |
|---|