EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H9O3S |
| Net Charge | -1 |
| Average Mass | 161.202 |
| Monoisotopic Mass | 161.02779 |
| SMILES | CSCCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C6H10O3S/c1-10-4-2-3-5(7)6(8)9/h2-4H2,1H3,(H,8,9)/p-1 |
| InChIKey | MPJMAJLPWRBNBU-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-methylthio-2-oxopentanoate (CHEBI:58815) is a ω-(methylthio)-2-oxocarboxylate (CHEBI:133493) |
| 5-methylthio-2-oxopentanoate (CHEBI:58815) is conjugate base of 5-methylthio-2-oxopentanoic acid (CHEBI:50260) |
| Incoming Relation(s) |
| 5-methylthio-2-oxopentanoic acid (CHEBI:50260) is conjugate acid of 5-methylthio-2-oxopentanoate (CHEBI:58815) |
| IUPAC Name |
|---|
| 5-(methylsulfanyl)-2-oxopentanoate |
| UniProt Name | Source |
|---|---|
| 2-(5-methylsulfanyl)oxopentanoate | UniProt |