EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (CH2)n.C4H5O3S |
| Net Charge | -1 |
| Average Mass | 147.175 |
| Monoisotopic Mass | 147.01214 |
| SMILES | CSCCC(=O)C(=O)[O-] |
| InChI | InChI=1S/C5H8O3S/c1-9-3-2-4(6)5(7)8/h2-3H2,1H3,(H,7,8)/p-1 |
| InChIKey | SXFSQZDSUWACKX-UHFFFAOYSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ω-(methylthio)-2-oxocarboxylate (CHEBI:133493) is a 2-oxo monocarboxylic acid anion (CHEBI:35179) |
| ω-(methylthio)-2-oxocarboxylate (CHEBI:133493) is conjugate base of ω-(methylthio)-2-oxocarboxylic acid (CHEBI:134529) |
| Incoming Relation(s) |
| 4-methylthio-2-oxobutanoate (CHEBI:16723) is a ω-(methylthio)-2-oxocarboxylate (CHEBI:133493) |
| 5-methylthio-2-oxopentanoate (CHEBI:58815) is a ω-(methylthio)-2-oxocarboxylate (CHEBI:133493) |
| ω-(methylthio)-2-oxocarboxylic acid (CHEBI:134529) is conjugate acid of ω-(methylthio)-2-oxocarboxylate (CHEBI:133493) |
| UniProt Name | Source |
|---|---|
| an ω-(methylsulfanyl)-2-oxoalkanoate | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-19485 | MetaCyc |
| Citations |
|---|