EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H47O9S |
| Net Charge | -1 |
| Average Mass | 547.731 |
| Monoisotopic Mass | 547.29463 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)C1C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@@H](O)C(CO)COS(=O)(=O)[O-])[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O9S/c1-15(4-7-22(30)16(13-28)14-36-37(33,34)35)19-5-6-20-25-21(12-24(32)27(19,20)3)26(2)9-8-18(29)10-17(26)11-23(25)31/h15-25,28-32H,4-14H2,1-3H3,(H,33,34,35)/p-1/t15-,16?,17+,18-,19-,20+,21?,22-,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | JKUSPYUETNXNRO-JWBDLDPOSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-scymnol sulfate(1−) (CHEBI:58808) is a steroid sulfate oxoanion (CHEBI:59696) |
| 5β-scymnol sulfate(1−) (CHEBI:58808) is conjugate base of 5β-scymnol sulfate (CHEBI:50107) |
| Incoming Relation(s) |
| 5β-scymnol sulfate (CHEBI:50107) is conjugate acid of 5β-scymnol sulfate(1−) (CHEBI:58808) |
| IUPAC Name |
|---|
| (24R)-3α,7α,12α,24,26-pentahydroxy-5β-cholestan-27-yl sulfate |
| Synonym | Source |
|---|---|
| 5β-scymnol sulfate anion | ChEBI |
| UniProt Name | Source |
|---|---|
| 5β-scymnol sulfate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7697279 | Beilstein |