EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H48O9S |
| Net Charge | 0 |
| Average Mass | 548.739 |
| Monoisotopic Mass | 548.30190 |
| SMILES | [H][C@@]12C[C@H](O)CC[C@]1(C)C1C[C@H](O)[C@@]3(C)[C@@]([H])(CC[C@]3([H])[C@H](C)CC[C@@H](O)C(CO)COS(=O)(=O)O)[C@]1([H])[C@H](O)C2 |
| InChI | InChI=1S/C27H48O9S/c1-15(4-7-22(30)16(13-28)14-36-37(33,34)35)19-5-6-20-25-21(12-24(32)27(19,20)3)26(2)9-8-18(29)10-17(26)11-23(25)31/h15-25,28-32H,4-14H2,1-3H3,(H,33,34,35)/t15-,16?,17+,18-,19-,20+,21?,22-,23-,24+,25+,26+,27-/m1/s1 |
| InChIKey | JKUSPYUETNXNRO-JWBDLDPOSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5β-scymnol sulfate (CHEBI:50107) has functional parent 5β-scymnol (CHEBI:50106) |
| 5β-scymnol sulfate (CHEBI:50107) is a steroid sulfate (CHEBI:16158) |
| 5β-scymnol sulfate (CHEBI:50107) is conjugate acid of 5β-scymnol sulfate(1−) (CHEBI:58808) |
| Incoming Relation(s) |
| 5β-scymnol sulfate(1−) (CHEBI:58808) is conjugate base of 5β-scymnol sulfate (CHEBI:50107) |
| IUPAC Name |
|---|
| (24R)-3α,7α,12α,24,26-pentahydroxy-5β-cholestan-27-yl hydrogen sulfate |
| Synonym | Source |
|---|---|
| 5beta-Scymnol sulfate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C16261 | KEGG COMPOUND |