EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H22N10O14P2 |
| Net Charge | -2 |
| Average Mass | 688.400 |
| Monoisotopic Mass | 688.08032 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@@H]4COP(=O)([O-])O[C@H]5[C@@H](O)[C@H](n6cnc7c(=O)nc(N)nc76)O[C@@H]5COP(=O)([O-])O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H24N10O14P2/c21-19-25-13-7(15(33)27-19)23-3-29(13)17-9(31)11-5(41-17)1-39-45(35,36)44-12-6(2-40-46(37,38)43-11)42-18(10(12)32)30-4-24-8-14(30)26-20(22)28-16(8)34/h3-6,9-12,17-18,31-32H,1-2H2,(H,35,36)(H,37,38)(H3,21,25,27,33)(H3,22,26,28,34)/p-2/t5-,6-,9-,10-,11-,12-,17-,18-/m1/s1 |
| InChIKey | PKFDLKSEZWEFGL-MHARETSRSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| c-di-GMP(2−) (CHEBI:58805) is a organophosphate oxoanion (CHEBI:58945) |
| c-di-GMP(2−) (CHEBI:58805) is conjugate base of c-di-GMP (CHEBI:49537) |
| Incoming Relation(s) |
| c-di-GMP (CHEBI:49537) is conjugate acid of c-di-GMP(2−) (CHEBI:58805) |
| Synonyms | Source |
|---|---|
| cyclic di-3',5'-guanylate dianion | ChEBI |
| cyclic di-3',5'-guanylate | ChEBI |
| UniProt Name | Source |
|---|---|
| 3',3'-c-di-GMP | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:9981635 | Beilstein |