EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:49537 - c-di-GMP
| Formula | C20H24N10O14P2 |
| Net Charge | 0 |
| Average Mass | 690.416 |
| Monoisotopic Mass | 690.09487 |
| SMILES | Nc1nc(=O)c2ncn([C@@H]3O[C@@H]4COP(=O)(O)O[C@H]5[C@@H](O)[C@H](n6cnc7c(=O)nc(N)nc76)O[C@@H]5COP(=O)(O)O[C@H]4[C@H]3O)c2n1 |
| InChI | InChI=1S/C20H24N10O14P2/c21-19-25-13-7(15(33)27-19)23-3-29(13)17-9(31)11-5(41-17)1-39-45(35,36)44-12-6(2-40-46(37,38)43-11)42-18(10(12)32)30-4-24-8-14(30)26-20(22)28-16(8)34/h3-6,9-12,17-18,31-32H,1-2H2,(H,35,36)(H,37,38)(H3,21,25,27,33)(H3,22,26,28,34)/t5-,6-,9-,10-,11-,12-,17-,18-/m1/s1 |
| InChIKey | PKFDLKSEZWEFGL-MHARETSRSA-N |
| Roles Classification |
|---|
| Biological Roles: | signalling molecule A molecular messenger in which the molecule is specifically involved in transmitting information between cells. Such molecules are released from the cell sending the signal, cross over the gap between cells by diffusion, and interact with specific receptors in another cell, triggering a response in that cell by activating a series of enzyme controlled reactions which lead to changes inside the cell. immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| Application: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| c-di-GMP (CHEBI:49537) has role immunomodulator (CHEBI:50846) |
| c-di-GMP (CHEBI:49537) has role signalling molecule (CHEBI:62488) |
| c-di-GMP (CHEBI:49537) is a cyclic purine dinucleotide (CHEBI:47037) |
| c-di-GMP (CHEBI:49537) is a guanyl ribonucleotide (CHEBI:61295) |
| c-di-GMP (CHEBI:49537) is conjugate acid of c-di-GMP(2−) (CHEBI:58805) |
| Incoming Relation(s) |
| c-di-GMP(2−) (CHEBI:58805) is conjugate base of c-di-GMP (CHEBI:49537) |
| IUPAC Name |
|---|
| 9,9'-[(2R,3R,3aS,7aR,9R,10R,10aS,14aR)-3,5,10,12-tetrahydroxy-5,12-dioxidooctahydro-2H,7H-difuro[3,2-d:3',2'-j][1,3,7,9,2,8]tetraoxadiphosphacyclododecine-2,9-diyl]bis(2-amino-1,9-dihydro-6H-purin-6-one) |
| Synonyms | Source |
|---|---|
| 3',5'-cyclic di-GMP | ChEBI |
| 3',5'-Cyclic diguanylic acid | KEGG COMPOUND |
| Bis-(3',5')-cyclic diGMP | KEGG COMPOUND |
| bis(3',5')-cyclic diguanylic acid | ChemIDplus |
| bis-(3'-5')-cyclic dimeric guanosine monophosphate | ChEBI |
| cdiGMP | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9606190 | Reaxys |
| Beilstein:9696190 | Beilstein |
| CAS:61093-23-0 | ChemIDplus |
| CAS:61093-23-0 | KEGG COMPOUND |
| Citations |
|---|