EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H15N2O5 |
| Net Charge | -1 |
| Average Mass | 231.228 |
| Monoisotopic Mass | 231.09865 |
| SMILES | [NH3+][C@@H](CCC(=O)NCCCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/p-1/t6-/m0/s1 |
| InChIKey | MKYPKZSGLSOGLL-LURJTMIESA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(L-γ-glutamylamino)butanoate (CHEBI:58800) is a α-amino-acid anion (CHEBI:33558) |
| 4-(L-γ-glutamylamino)butanoate (CHEBI:58800) is conjugate base of 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) |
| Incoming Relation(s) |
| 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) is conjugate acid of 4-(L-γ-glutamylamino)butanoate (CHEBI:58800) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-[(3-carboxylatopropyl)amino]-5-oxopentanoate |
| Synonyms | Source |
|---|---|
| (2S)-2-ammonio-5-[(3-carboxylatopropyl)amino]-5-oxopentanoate | ChEBI |
| (2S)-2-azaniumyl-4-[(3-carboxylatopropyl)carbamoyl]butanoate | ChEBI |
| N5-(3-carboxylatopropyl)-L-glutamine | ChEBI |
| UniProt Name | Source |
|---|---|
| 4-(γ-L-glutamylamino)butanoate | UniProt |