EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:49260 - 4-(L-γ-glutamylamino)butanoic acid
| Formula | C9H16N2O5 |
| Net Charge | 0 |
| Average Mass | 232.236 |
| Monoisotopic Mass | 232.10592 |
| SMILES | N[C@@H](CCC(=O)NCCCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H16N2O5/c10-6(9(15)16)3-4-7(12)11-5-1-2-8(13)14/h6H,1-5,10H2,(H,11,12)(H,13,14)(H,15,16)/t6-/m0/s1 |
| InChIKey | MKYPKZSGLSOGLL-LURJTMIESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) has part L-γ-glutamyl group (CHEBI:32474) |
| 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) has role Escherichia coli metabolite (CHEBI:76971) |
| 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) is a N-acyl-γ-aminobutyric acid (CHEBI:134018) |
| 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) is a amino dicarboxylic acid (CHEBI:36164) |
| 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) is conjugate acid of 4-(L-γ-glutamylamino)butanoate (CHEBI:58800) |
| Incoming Relation(s) |
| 4-(L-γ-glutamylamino)butanoate (CHEBI:58800) is conjugate base of 4-(L-γ-glutamylamino)butanoic acid (CHEBI:49260) |
| IUPAC Names |
|---|
| 4-(L-γ-glutamylamino)butanoic acid |
| N5-(3-carboxypropyl)-L-glutamine |
| Synonyms | Source |
|---|---|
| 4-(Glutamylamino)butanoate | KEGG COMPOUND |
| 4-(L-glutam-5-ylamino)butanoic acid | ChEBI |
| gamma Glutamyl GABA | ChemIDplus |
| gamma-Glutamyl-GABA | KEGG COMPOUND |
| gamma-L-Glu-gamma-abu | ChemIDplus |
| gamma-L-Glutamyl-gamma-aminobutyric acid | ChemIDplus |