EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H10NO5 |
| Net Charge | -1 |
| Average Mass | 224.192 |
| Monoisotopic Mass | 224.05645 |
| SMILES | C=C(O[C@H]1C=CC=C(C(=O)[O-])[C@@H]1[NH3+])C(=O)[O-] |
| InChI | InChI=1S/C10H11NO5/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8H,1,11H2,(H,12,13)(H,14,15)/p-1/t7-,8-/m0/s1 |
| InChIKey | OKLGKGPAZUNROU-YUMQZZPRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-azaniumyl-2-deoxyisochorismate (CHEBI:58792) is a dicarboxylic acid monoanion (CHEBI:35695) |
| 2-azaniumyl-2-deoxyisochorismate (CHEBI:58792) is conjugate base of 2-amino-2-deoxyisochorismic acid (CHEBI:49197) |
| Incoming Relation(s) |
| 2-amino-2-deoxyisochorismic acid (CHEBI:49197) is conjugate acid of 2-azaniumyl-2-deoxyisochorismate (CHEBI:58792) |
| IUPAC Name |
|---|
| (5S,6S)-6-azaniumyl-5-[(1-carboxylatoethenyl)oxy]cyclohexa-1,3-diene-1-carboxylate |
| UniProt Name | Source |
|---|---|
| (2S)-2-amino-4-deoxychorismate | UniProt |