EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H11NO5 |
| Net Charge | 0 |
| Average Mass | 225.200 |
| Monoisotopic Mass | 225.06372 |
| SMILES | C=C(O[C@H]1C=CC=C(C(=O)O)[C@@H]1N)C(=O)O |
| InChI | InChI=1S/C10H11NO5/c1-5(9(12)13)16-7-4-2-3-6(8(7)11)10(14)15/h2-4,7-8H,1,11H2,(H,12,13)(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | OKLGKGPAZUNROU-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-amino-2-deoxyisochorismic acid (CHEBI:49197) is a dicarboxylic acid (CHEBI:35692) |
| 2-amino-2-deoxyisochorismic acid (CHEBI:49197) is conjugate acid of 2-azaniumyl-2-deoxyisochorismate (CHEBI:58792) |
| Incoming Relation(s) |
| 2-azaniumyl-2-deoxyisochorismate (CHEBI:58792) is conjugate base of 2-amino-2-deoxyisochorismic acid (CHEBI:49197) |
| IUPAC Name |
|---|
| (5S,6S)-6-amino-5-[(1-carboxyethenyl)oxy]cyclohexa-1,3-diene-1-carboxylic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-Amino-4-deoxychorismate | KEGG COMPOUND |
| (5S,6S)-6-amino-5-[(1-carboxyvinyl)oxy]cyclohexa-1,3-diene-1-carboxylic acid | IUPAC |
| ADIC | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C18054 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:5908196 | Beilstein |