EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO7 |
| Net Charge | -3 |
| Average Mass | 244.179 |
| Monoisotopic Mass | 244.04737 |
| SMILES | O=C([O-])CCC(=O)N[C@@H](CCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H13NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/p-3/t5-/m0/s1 |
| InChIKey | JCNBNOQGFSXOML-YFKPBYRVSA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(3-carboxylatopropanoyl)-L-glutamate(3−) (CHEBI:58763) is a tricarboxylic acid trianion (CHEBI:27092) |
| N-(3-carboxylatopropanoyl)-L-glutamate(3−) (CHEBI:58763) is conjugate base of N2-succinyl-L-glutamic acid (CHEBI:48957) |
| Incoming Relation(s) |
| N2-succinyl-L-glutamic acid (CHEBI:48957) is conjugate acid of N-(3-carboxylatopropanoyl)-L-glutamate(3−) (CHEBI:58763) |
| IUPAC Name |
|---|
| N-(3-carboxylatopropanoyl)-L-glutamate |
| UniProt Name | Source |
|---|---|
| N-succinyl-L-glutamate | UniProt |