EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO7 |
| Net Charge | 0 |
| Average Mass | 247.203 |
| Monoisotopic Mass | 247.06920 |
| SMILES | O=C(O)CCC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChI | InChI=1S/C9H13NO7/c11-6(2-4-8(14)15)10-5(9(16)17)1-3-7(12)13/h5H,1-4H2,(H,10,11)(H,12,13)(H,14,15)(H,16,17)/t5-/m0/s1 |
| InChIKey | JCNBNOQGFSXOML-YFKPBYRVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) | |
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N2-succinyl-L-glutamic acid (CHEBI:48957) has role Escherichia coli metabolite (CHEBI:76971) |
| N2-succinyl-L-glutamic acid (CHEBI:48957) has role mouse metabolite (CHEBI:75771) |
| N2-succinyl-L-glutamic acid (CHEBI:48957) is a N-acyl-L-glutamic acid (CHEBI:21650) |
| N2-succinyl-L-glutamic acid (CHEBI:48957) is a tricarboxylic acid (CHEBI:27093) |
| N2-succinyl-L-glutamic acid (CHEBI:48957) is conjugate acid of N-(3-carboxylatopropanoyl)-L-glutamate(3−) (CHEBI:58763) |
| Incoming Relation(s) |
| N-(3-carboxylatopropanoyl)-L-glutamate(3−) (CHEBI:58763) is conjugate base of N2-succinyl-L-glutamic acid (CHEBI:48957) |
| IUPAC Name |
|---|
| N-(3-carboxypropanoyl)-L-glutamic acid |
| Synonyms | Source |
|---|---|
| N2-Succinyl-L-glutamate | KEGG COMPOUND |
| N-(3-carboxy-1-oxopropyl)-L-glutamic acid | ChemIDplus |
| (2S)-2-(3-Carboxypropanoylamino)pentanedioic acid | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05931 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1715224 | Beilstein |
| CAS:33981-72-5 | ChemIDplus |