EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33O7P2 |
| Net Charge | -3 |
| Average Mass | 447.425 |
| Monoisotopic Mass | 447.17180 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COP(=O)([O-])OP(=O)([O-])[O-] |
| InChI | InChI=1S/C20H36O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/p-3/b18-11+,19-13+,20-15+ |
| InChIKey | OINNEUNVOZHBOX-QIRCYJPOSA-K |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | - | DOI (10.1038/nbt.2488) | |
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Roles: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) has role human metabolite (CHEBI:77746) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) is a geranylgeranyl diphosphate(3−) (CHEBI:57533) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) is a organophosphate oxoanion (CHEBI:58945) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) is conjugate base of 2-trans,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:48861) |
| Incoming Relation(s) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:48861) is conjugate acid of 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) |
| IUPAC Name |
|---|
| (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl diphosphate |
| UniProt Name | Source |
|---|---|
| (2E,6E,10E)-geranylgeranyl diphosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3574726 | Beilstein |