EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H36O7P2 |
| Net Charge | 0 |
| Average Mass | 450.449 |
| Monoisotopic Mass | 450.19363 |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/CC/C(C)=C/COP(=O)(O)OP(=O)(O)O |
| InChI | InChI=1S/C20H36O7P2/c1-17(2)9-6-10-18(3)11-7-12-19(4)13-8-14-20(5)15-16-26-29(24,25)27-28(21,22)23/h9,11,13,15H,6-8,10,12,14,16H2,1-5H3,(H,24,25)(H2,21,22,23)/b18-11+,19-13+,20-15+ |
| InChIKey | OINNEUNVOZHBOX-QIRCYJPOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Role: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:48861) has role mouse metabolite (CHEBI:75771) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:48861) is a geranylgeranyl diphosphate (CHEBI:15831) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:48861) is conjugate acid of 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) |
| Incoming Relation(s) |
| 2-trans,6-trans,10-trans-geranylgeranyl diphosphate(3−) (CHEBI:58756) is conjugate base of 2-trans,6-trans,10-trans-geranylgeranyl diphosphate (CHEBI:48861) |
| IUPAC Name |
|---|
| (2E,6E,10E)-3,7,11,15-tetramethylhexadeca-2,6,10,14-tetraen-1-yl trihydrogen diphosphate |
| Synonyms | Source |
|---|---|
| all-trans-Geranylgeranyl diphosphate | KEGG COMPOUND |
| all-trans-Geranylgeranyl pyrophosphate | KEGG COMPOUND |
| Geranylgeranyl diphosphate | KEGG COMPOUND |
| GERANYLGERANYL DIPHOSPHATE | PDBeChem |
| Geranylgeranyl pyrophosphate | KEGG COMPOUND |
| GGDP | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00000908 | KNApSAcK |
| C00353 | KEGG COMPOUND |
| GRG | PDBeChem |
| LMPR0104010001 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1896121 | Beilstein |
| CAS:6699-20-3 | ChemIDplus |
| CAS:6699-20-3 | KEGG COMPOUND |