EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H33MgN4O6 |
| Net Charge | -1 |
| Average Mass | 629.976 |
| Monoisotopic Mass | 629.22560 |
| SMILES | C=Cc1c(C)c2[n]3c1=CC1=[N+]4C(=Cc5c(C)c6c7[n]5[Mg-2]34[N+]3=C(C=2)[C@@H](C)[C@H](CCC(=O)[O-])C3=C7[C@@H](C(=O)OC)C6=O)C(CC)=C1CO |
| InChI | InChI=1S/C35H36N4O6.Mg/c1-7-18-15(3)22-11-23-16(4)20(9-10-28(41)42)32(38-23)30-31(35(44)45-6)34(43)29-17(5)24(39-33(29)30)12-26-19(8-2)21(14-40)27(37-26)13-25(18)36-22;/h7,11-13,16,20,31,40H,1,8-10,14H2,2-6H3,(H3,36,37,38,39,41,42,43);/q;+2/p-3/t16-,20-,31+;/m0./s1 |
| InChIKey | QCWXXDQFRHDXNM-IEEIVXFASA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 71-hydroxychlorophyllide a(1−) (CHEBI:58741) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| 71-hydroxychlorophyllide a(1−) (CHEBI:58741) is conjugate acid of 71-hydroxychlorophyllide a(2−) (CHEBI:83357) |
| 71-hydroxychlorophyllide a(1−) (CHEBI:58741) is conjugate base of 71-hydroxychlorophyllide a (CHEBI:48396) |
| Incoming Relation(s) |
| 71-hydroxychlorophyllide a (CHEBI:48396) is conjugate acid of 71-hydroxychlorophyllide a(1−) (CHEBI:58741) |
| 71-hydroxychlorophyllide a(2−) (CHEBI:83357) is conjugate base of 71-hydroxychlorophyllide a(1−) (CHEBI:58741) |