EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H34MgN4O6 |
| Net Charge | 0 |
| Average Mass | 630.984 |
| Monoisotopic Mass | 630.23288 |
| SMILES | C=Cc1c(C)/c2[n]3/c1=C\C1=N/C(=C\c4c(C)c5c([n]4[Mg]3)/C(=C3\N=C(/C=2)[C@@H](C)[C@@H]3CCC(=O)O)[C@@H](C(=O)OC)C5=O)C(CC)=C1CO |
| InChI | InChI=1S/C35H36N4O6.Mg/c1-7-18-15(3)22-11-23-16(4)20(9-10-28(41)42)32(38-23)30-31(35(44)45-6)34(43)29-17(5)24(39-33(29)30)12-26-19(8-2)21(14-40)27(37-26)13-25(18)36-22;/h7,11-13,16,20,31,40H,1,8-10,14H2,2-6H3,(H3,36,37,38,39,41,42,43);/q;+2/p-2/t16-,20-,31+;/m0./s1 |
| InChIKey | QCWXXDQFRHDXNM-IEEIVXFASA-L |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 71-hydroxychlorophyllide a (CHEBI:48396) has functional parent chlorophyllide a (CHEBI:16900) |
| 71-hydroxychlorophyllide a (CHEBI:48396) is a chlorophyllide (CHEBI:38206) |
| 71-hydroxychlorophyllide a (CHEBI:48396) is a dicarboxylic acid monoester (CHEBI:36244) |
| 71-hydroxychlorophyllide a (CHEBI:48396) is a methyl ester (CHEBI:25248) |
| 71-hydroxychlorophyllide a (CHEBI:48396) is conjugate acid of 71-hydroxychlorophyllide a(1−) (CHEBI:58741) |
| Incoming Relation(s) |
| 71-hydroxychlorophyllide a(1−) (CHEBI:58741) is conjugate base of 71-hydroxychlorophyllide a (CHEBI:48396) |
| Synonym | Source |
|---|---|
| [3-{(3S,4S,21R)-9-ethenyl-14-ethyl-13-(hydroxymethyl)-4,8,18-trimethyl-21-[(methyloxy)carbonyl]-20-oxophorbin-3-yl-κ4N23,N24,N25,N26}propanoato(2−)]magnesium | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| C16540 | KEGG COMPOUND |