EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H20N3O3 |
| Net Charge | +1 |
| Average Mass | 218.277 |
| Monoisotopic Mass | 218.14992 |
| SMILES | [NH3+]CCCCNC(=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C9H19N3O3/c10-5-1-2-6-12-8(13)4-3-7(11)9(14)15/h7H,1-6,10-11H2,(H,12,13)(H,14,15)/p+1/t7-/m0/s1 |
| InChIKey | WKGTVHGVLRCTCF-ZETCQYMHSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-L-glutamylputrescinium(1+) (CHEBI:58731) is a primary ammonium ion (CHEBI:65296) |
| γ-L-glutamylputrescinium(1+) (CHEBI:58731) is conjugate acid of γ-L-glutamylputrescine (CHEBI:48005) |
| Incoming Relation(s) |
| γ-L-glutamylputrescine (CHEBI:48005) is conjugate base of γ-L-glutamylputrescinium(1+) (CHEBI:58731) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-5-[(4-azaniumylbutyl)amino]-5-oxopentanoate |
| UniProt Name | Source |
|---|---|
| γ-L-glutamylputrescine | UniProt |