EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:48005 - γ-L-glutamylputrescine
| Formula | C9H19N3O3 |
| Net Charge | 0 |
| Average Mass | 217.269 |
| Monoisotopic Mass | 217.14264 |
| SMILES | NCCCCNC(=O)CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H19N3O3/c10-5-1-2-6-12-8(13)4-3-7(11)9(14)15/h7H,1-6,10-11H2,(H,12,13)(H,14,15)/t7-/m0/s1 |
| InChIKey | WKGTVHGVLRCTCF-ZETCQYMHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| γ-L-glutamylputrescine (CHEBI:48005) has role Escherichia coli metabolite (CHEBI:76971) |
| γ-L-glutamylputrescine (CHEBI:48005) is a L-glutamine derivative (CHEBI:24317) |
| γ-L-glutamylputrescine (CHEBI:48005) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| γ-L-glutamylputrescine (CHEBI:48005) is a γ-glutamylputrescine (CHEBI:48006) |
| γ-L-glutamylputrescine (CHEBI:48005) is conjugate base of γ-L-glutamylputrescinium(1+) (CHEBI:58731) |
| Incoming Relation(s) |
| γ-L-glutamylputrescinium(1+) (CHEBI:58731) is conjugate acid of γ-L-glutamylputrescine (CHEBI:48005) |
| IUPAC Name |
|---|
| N5-(4-aminobutyl)-L-glutamine |
| Synonym | Source |
|---|---|
| gamma-L-Glutamylputrescine | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C15699 | KEGG COMPOUND |