EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H31MgN4O6 |
| Net Charge | -1 |
| Average Mass | 627.960 |
| Monoisotopic Mass | 627.20995 |
| SMILES | C=Cc1c(C)/c2[n]3/c1=C\C1=N/C(=C\c4c(C)c5c([n]4[Mg]3)/C(=C3\N=C(/C=2)[C@@H](C)[C@@H]3CCC(=O)[O-])[C@@H](C(=O)OC)C5=O)C(CC)=C1C=O |
| InChI | InChI=1S/C35H34N4O6.Mg/c1-7-18-15(3)22-11-23-16(4)20(9-10-28(41)42)32(38-23)30-31(35(44)45-6)34(43)29-17(5)24(39-33(29)30)12-26-19(8-2)21(14-40)27(37-26)13-25(18)36-22;/h7,11-14,16,20,31H,1,8-10H2,2-6H3,(H3,36,37,38,39,40,41,42,43);/q;+2/p-3/t16-,20-,31+;/m0./s1 |
| InChIKey | QPDWBRHRBKXUNS-IEEIVXFASA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorophyllide b(1−) (CHEBI:58686) is a cyclic tetrapyrrole anion (CHEBI:58941) |
| chlorophyllide b(1−) (CHEBI:58686) is a monocarboxylic acid anion (CHEBI:35757) |
| chlorophyllide b(1−) (CHEBI:58686) is conjugate acid of chlorophyllide b(2−) (CHEBI:83356) |
| chlorophyllide b(1−) (CHEBI:58686) is conjugate base of chlorophyllide b (CHEBI:38209) |
| Incoming Relation(s) |
| chlorophyllide b (CHEBI:38209) is conjugate acid of chlorophyllide b(1−) (CHEBI:58686) |
| chlorophyllide b(2−) (CHEBI:83356) is conjugate base of chlorophyllide b(1−) (CHEBI:58686) |
| Synonym | Source |
|---|---|
| chlorophyllide b anion | ChEBI |