EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H32MgN4O6 |
| Net Charge | 0 |
| Average Mass | 628.968 |
| Monoisotopic Mass | 628.21723 |
| SMILES | [H]C(=O)C1=C(CC)C2=N/C1=C\c1c(C=C)c(C)c3[n]1[Mg][n]1c4c(c(C)/c1=C/2)C(=O)[C@H](C(=O)OC)C=4C1=N/C(=C\3)[C@@H](C)[C@@H]1CCC(=O)O |
| InChI | InChI=1S/C35H34N4O6.Mg/c1-7-18-15(3)22-11-23-16(4)20(9-10-28(41)42)32(38-23)30-31(35(44)45-6)34(43)29-17(5)24(39-33(29)30)12-26-19(8-2)21(14-40)27(37-26)13-25(18)36-22;/h7,11-14,16,20,31H,1,8-10H2,2-6H3,(H3,36,37,38,39,40,41,42,43);/q;+2/p-2/t16-,20-,31+;/m0./s1 |
| InChIKey | QPDWBRHRBKXUNS-IEEIVXFASA-L |
| Roles Classification |
|---|
| Biological Role: | cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| chlorophyllide b (CHEBI:38209) is a chlorophyllide (CHEBI:38206) |
| chlorophyllide b (CHEBI:38209) is conjugate acid of chlorophyllide b(1−) (CHEBI:58686) |
| Incoming Relation(s) |
| chlorophyll b (CHEBI:27888) has functional parent chlorophyllide b (CHEBI:38209) |
| chlorophyllide b(1−) (CHEBI:58686) is conjugate base of chlorophyllide b (CHEBI:38209) |
| Synonyms | Source |
|---|---|
| chlorophyllide b | JCBN |
| Chlorophyllid b | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C16541 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:10054580 | Beilstein |
| Beilstein:8967487 | Beilstein |
| CAS:14428-12-7 | ChemIDplus |