EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H17N2O7 |
| Net Charge | -1 |
| Average Mass | 301.275 |
| Monoisotopic Mass | 301.10412 |
| SMILES | O=C([O-])C(=O)CC[NH2+][C@@H](CC[NH+]1CC[C@H]1C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C12H18N2O7/c15-9(12(20)21)1-4-13-7(10(16)17)2-5-14-6-3-8(14)11(18)19/h7-8,13H,1-6H2,(H,16,17)(H,18,19)(H,20,21)/p-1/t7-,8-/m0/s1 |
| InChIKey | PSBHIGYNXQIUQY-YUMQZZPRSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3''-deamino-3''-oxonicotianaminium(1−) (CHEBI:58685) is a tricarboxylic acid anion (CHEBI:35753) |
| 3''-deamino-3''-oxonicotianaminium(1−) (CHEBI:58685) is conjugate base of 3''-deamino-3''-oxonicotianamine (CHEBI:38160) |
| Incoming Relation(s) |
| 3''-deamino-3''-oxonicotianamine (CHEBI:38160) is conjugate acid of 3''-deamino-3''-oxonicotianaminium(1−) (CHEBI:58685) |
| IUPAC Name |
|---|
| (2S)-1-{(3S)-3-carboxylato-3-[(3-carboxylato-3-oxopropyl)azaniumyl]propyl}azetidinium-2-carboxylate |
| UniProt Name | Source |
|---|---|
| 3''-deamino-3''-oxonicotianamine | UniProt |