EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O7 |
| Net Charge | 0 |
| Average Mass | 302.283 |
| Monoisotopic Mass | 302.11140 |
| SMILES | O=C(O)C(=O)CCN[C@@H](CCN1CC[C@H]1C(=O)O)C(=O)O |
| InChI | InChI=1S/C12H18N2O7/c15-9(12(20)21)1-4-13-7(10(16)17)2-5-14-6-3-8(14)11(18)19/h7-8,13H,1-6H2,(H,16,17)(H,18,19)(H,20,21)/t7-,8-/m0/s1 |
| InChIKey | PSBHIGYNXQIUQY-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | phytosiderophore Any of low-molecular-mass iron(III)-chelating compounds produced by plants for the purpose of the transport and sequestration of iron. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3''-deamino-3''-oxonicotianamine (CHEBI:38160) is a mugineic acids (CHEBI:25427) |
| 3''-deamino-3''-oxonicotianamine (CHEBI:38160) is conjugate acid of 3''-deamino-3''-oxonicotianaminium(1−) (CHEBI:58685) |
| Incoming Relation(s) |
| 3''-deamino-3''-oxonicotianaminium(1−) (CHEBI:58685) is conjugate base of 3''-deamino-3''-oxonicotianamine (CHEBI:38160) |
| IUPAC Name |
|---|
| (2S)-1-{(3S)-3-carboxy-3-[(3-carboxy-3-oxopropyl)amino]propyl}azetidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| C15486 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:7825879 | Beilstein |