EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C7H15Cl2N2O2P |
| Net Charge | 0 |
| Average Mass | 261.089 |
| Monoisotopic Mass | 260.02482 |
| SMILES | O=P1(NCCCl)OCCCN1CCCl |
| InChI | InChI=1S/C7H15Cl2N2O2P/c8-2-4-10-14(12)11(6-3-9)5-1-7-13-14/h1-7H2,(H,10,12) |
| InChIKey | HOMGKSMUEGBAAB-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | environmental contaminant Any minor or unwanted substance introduced into the environment that can have undesired effects. |
| Biological Roles: | immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. xenobiotic A xenobiotic (Greek, xenos "foreign"; bios "life") is a compound that is foreign to a living organism. Principal xenobiotics include: drugs, carcinogens and various compounds that have been introduced into the environment by artificial means. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. alkylating agent Highly reactive chemical that introduces alkyl radicals into biologically active molecules and thereby prevents their proper functioning. It could be used as an antineoplastic agent, but it might be very toxic, with carcinogenic, mutagenic, teratogenic, and immunosuppressant actions. It could also be used as a component of poison gases. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ifosfamide (CHEBI:5864) has role alkylating agent (CHEBI:22333) |
| ifosfamide (CHEBI:5864) has role antineoplastic agent (CHEBI:35610) |
| ifosfamide (CHEBI:5864) has role environmental contaminant (CHEBI:78298) |
| ifosfamide (CHEBI:5864) has role immunosuppressive agent (CHEBI:35705) |
| ifosfamide (CHEBI:5864) has role xenobiotic (CHEBI:35703) |
| ifosfamide (CHEBI:5864) is a ifosfamides (CHEBI:55369) |
| IUPAC Name |
|---|
| N,3-bis(2-chloroethyl)-1,3,2-oxazaphosphinan-2-amine 2-oxide |
| INNs | Source |
|---|---|
| ifosfamida | ChemIDplus |
| ifosfamide | ChemIDplus |
| ifosfamidum | ChemIDplus |
| Synonyms | Source |
|---|---|
| 3-(2-chloroethyl)-2-((2-chloroethyl)amino)tetrahydro-2H-1,3,2-oxazaphosphorine 2-oxide | ChemIDplus |
| Iphosphamide | DrugBank |
| Isofosfamide | DrugBank |
| Isophosphamide | ChemIDplus |
| Isophosphamide | KEGG COMPOUND |
| isosfamide | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 1421 | DrugCentral |
| C07047 | KEGG COMPOUND |
| D00343 | KEGG DRUG |
| DB01181 | DrugBank |
| HMDB0015312 | HMDB |
| Ifosfamide | Wikipedia |
| LSM-5118 | LINCS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5802893 | Reaxys |
| Beilstein:611835 | Beilstein |
| CAS:3778-73-2 | KEGG COMPOUND |
| CAS:3778-73-2 | ChemIDplus |
| Citations |
|---|