EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H9N2O4 |
| Net Charge | -1 |
| Average Mass | 197.170 |
| Monoisotopic Mass | 197.05678 |
| SMILES | [NH3+][C@@H](Cn1ccc(=O)c([O-])c1)C(=O)[O-] |
| InChI | InChI=1S/C8H10N2O4/c9-5(8(13)14)3-10-2-1-6(11)7(12)4-10/h1-2,4-5,12H,3,9H2,(H,13,14)/p-1/t5-/m0/s1 |
| InChIKey | WZNJWVWKTVETCG-YFKPBYRVSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-mimosine(1−) (CHEBI:58604) is a organic anion (CHEBI:25696) |
| L-mimosine(1−) (CHEBI:58604) is conjugate base of L-mimosine (CHEBI:29063) |
| Incoming Relation(s) |
| L-mimosine (CHEBI:29063) is conjugate acid of L-mimosine(1−) (CHEBI:58604) |
| IUPAC Name |
|---|
| (2S)-2-azaniumyl-3-(3-oxido-4-oxopyridin-1(4H)-yl)propanoate |