EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:29063 - L-mimosine
| Formula | C8H10N2O4 |
| Net Charge | 0 |
| Average Mass | 198.178 |
| Monoisotopic Mass | 198.06406 |
| SMILES | N[C@@H](Cn1ccc(=O)c(O)c1)C(=O)O |
| InChI | InChI=1S/C8H10N2O4/c9-5(8(13)14)3-10-2-1-6(11)7(12)4-10/h1-2,4-5,12H,3,9H2,(H,13,14)/t5-/m0/s1 |
| InChIKey | WZNJWVWKTVETCG-YFKPBYRVSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. EC 1.14.18.1 (tyrosinase) inhibitor Any EC 1.14.18.* (oxidoreductase acting on paired donors, miscellaneous compound as one donor, incorporating 1 atom of oxygen) inhibitor that interferes with the action of tyrosinase (monophenol monooxygenase), EC 1.14.18.1, an enzyme that catalyses the oxidation of phenols (such as tyrosine) and is widespread in plants and animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-mimosine (CHEBI:29063) has functional parent propionic acid (CHEBI:30768) |
| L-mimosine (CHEBI:29063) has role EC 1.14.18.1 (tyrosinase) inhibitor (CHEBI:59997) |
| L-mimosine (CHEBI:29063) has role plant metabolite (CHEBI:76924) |
| L-mimosine (CHEBI:29063) is a 4-pyridones (CHEBI:20485) |
| L-mimosine (CHEBI:29063) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| L-mimosine (CHEBI:29063) is conjugate acid of L-mimosine(1−) (CHEBI:58604) |
| L-mimosine (CHEBI:29063) is tautomer of L-mimosine zwitterion (CHEBI:77689) |
| Incoming Relation(s) |
| L-mimosine(1−) (CHEBI:58604) is conjugate base of L-mimosine (CHEBI:29063) |
| L-mimosine zwitterion (CHEBI:77689) is tautomer of L-mimosine (CHEBI:29063) |
| IUPAC Name |
|---|
| (2S)-2-amino-3-(3-hydroxy-4-oxopyridin-1(4H)-yl)propanoic acid |
| Synonyms | Source |
|---|---|
| L-Mimosine | KEGG COMPOUND |
| (S)-2-amino-3-(3-hydroxy-4-oxo-4H-pyridin-1-yl)propanoate | ChEBI |
| (S)-2-Amino-3-(3-hydroxy-4-oxo-4H-pyridin-1-yl)propanoate | KEGG COMPOUND |
| Citations |
|---|