EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N4O5P |
| Net Charge | -1 |
| Average Mass | 253.175 |
| Monoisotopic Mass | 253.07073 |
| SMILES | [NH2+]=C(NCCC[C@H]([NH3+])C(=O)[O-])NP(=O)([O-])[O-] |
| InChI | InChI=1S/C6H15N4O5P/c7-4(5(11)12)2-1-3-9-6(8)10-16(13,14)15/h4H,1-3,7H2,(H,11,12)(H5,8,9,10,13,14,15)/p-1/t4-/m0/s1 |
| InChIKey | CCTIOCVIZPCTGO-BYPYZUCNSA-M |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω-phosphonato-L-arginine (CHEBI:58477) is a organophosphate oxoanion (CHEBI:58945) |
| Nω-phosphonato-L-arginine (CHEBI:58477) is a α-amino-acid anion (CHEBI:33558) |
| Nω-phosphonato-L-arginine (CHEBI:58477) is conjugate base of Nω-phospho-L-arginine (CHEBI:18412) |
| Incoming Relation(s) |
| Nω-phospho-L-arginine (CHEBI:18412) is conjugate acid of Nω-phosphonato-L-arginine (CHEBI:58477) |
| Nω-phospho-L-arginine(1−) residue (CHEBI:83226) is substituent group from Nω-phosphonato-L-arginine (CHEBI:58477) |
| IUPAC Name |
|---|
| (2S)-2-ammonio-5-{[iminio(phosphonatoamino)methyl]amino}pentanoate |
| UniProt Name | Source |
|---|---|
| Nω-phospho-L-arginine | UniProt |