EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H15N4O5P |
| Net Charge | 0 |
| Average Mass | 254.183 |
| Monoisotopic Mass | 254.07801 |
| SMILES | N=C(NCCC[C@H](N)C(=O)O)NP(=O)(O)O |
| InChI | InChI=1S/C6H15N4O5P/c7-4(5(11)12)2-1-3-9-6(8)10-16(13,14)15/h4H,1-3,7H2,(H,11,12)(H5,8,9,10,13,14,15)/t4-/m0/s1 |
| InChIKey | CCTIOCVIZPCTGO-BYPYZUCNSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Nω-phospho-L-arginine (CHEBI:18412) has role animal metabolite (CHEBI:75767) |
| Nω-phospho-L-arginine (CHEBI:18412) is a L-arginine derivative (CHEBI:83965) |
| Nω-phospho-L-arginine (CHEBI:18412) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Nω-phospho-L-arginine (CHEBI:18412) is a phosphagen (CHEBI:64618) |
| Nω-phospho-L-arginine (CHEBI:18412) is a phosphoamino acid (CHEBI:26051) |
| Nω-phospho-L-arginine (CHEBI:18412) is conjugate acid of Nω-phosphonato-L-arginine (CHEBI:58477) |
| Incoming Relation(s) |
| Nω-phosphonato-L-arginine (CHEBI:58477) is conjugate base of Nω-phospho-L-arginine (CHEBI:18412) |
| IUPAC Name |
|---|
| Nω-phosphono-L-arginine |
| Synonyms | Source |
|---|---|
| (2S)-2-amino-5-{[imino(phosphonoamino)methyl]amino}pentanoic acid | ChEBI |
| alpha-amino-delta-phosphonoguanidinovaleric acid | ChEBI |
| Arginine phosphate | KEGG COMPOUND |
| N5-[imino(phosphonoamino)methyl]-L-ornithine | ChEBI |
| L-Arginine-NG-phosphoric acid | KEGG COMPOUND |
| L-Arginine phosphate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C05945 | KEGG COMPOUND |
| HMDB0029438 | HMDB |
| RPI | PDBeChem |
| Registry Numbers | Sources |
|---|---|
| Beilstein:1729410 | Beilstein |
| Reaxys:1729410 | Reaxys |
| CAS:1189-11-3 | ChemIDplus |
| CAS:1189-11-3 | KEGG COMPOUND |
| Citations |
|---|