EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:58465 - dermatan sulfate polyanion
| Formula | (C14H19NO14S)n.H2O |
| Net Charge | -2 |
| Average Mass | 475.381 |
| Monoisotopic Mass | 475.06429 |
| SMILES | [H]O[C@@H]1O[C@H](CO)[C@H](OS(=O)(=O)[O-])[C@H](O[C@@H]2O[C@@H](C(=O)[O-])[C@@H](O)[C@H](O)[C@H]2O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H23NO15S/c1-3(17)15-5-10(9(30-31(24,25)26)4(2-16)27-13(5)23)28-14-8(20)6(18)7(19)11(29-14)12(21)22/h4-11,13-14,16,18-20,23H,2H2,1H3,(H,15,17)(H,21,22)(H,24,25,26)/p-2/t4-,5-,6+,7+,8-,9+,10-,11-,13-,14-/m1/s1 |
| InChIKey | AVJBPWGFOQAPRH-FWMKGIEWSA-L |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dermatan sulfate polyanion (CHEBI:58465) is a monocarboxylic acid anion (CHEBI:35757) |
| dermatan sulfate polyanion (CHEBI:58465) is a organosulfate oxoanion (CHEBI:58958) |
| dermatan sulfate polyanion (CHEBI:58465) is a polyanionic polymer (CHEBI:61469) |
| dermatan sulfate polyanion (CHEBI:58465) is conjugate base of dermatan sulfate (CHEBI:18376) |
| Incoming Relation(s) |
| N-acetyl-β-D-galactosaminyl-(1→4)-α-L-iduronyl-(1→3)-N-acetyl-β-D-4-sulfogalactosaminyl-(1→4)-α-L-iduronyl-(1→3)-N-acetyl-D-4-sulfogalactosamine(4−) (CHEBI:152565) has functional parent dermatan sulfate polyanion (CHEBI:58465) |
| dermatan 4',6'-disulfate anion (CHEBI:138121) has functional parent dermatan sulfate polyanion (CHEBI:58465) |
| α-L-iduronyl-(1→3)-N-acetyl-β-D-4-sulfogalactosaminyl-(1→4)-α-L-iduronyl-(1→3)-N-acetyl-D-4-sulfogalactosamine(4−) (CHEBI:152566) has parent hydride dermatan sulfate polyanion (CHEBI:58465) |
| dermatan sulfate (CHEBI:18376) is conjugate acid of dermatan sulfate polyanion (CHEBI:58465) |
| UniProt Name | Source |
|---|---|
| dermatan 4'-sulfate | UniProt |