EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18376 - dermatan sulfate
| Formula | (C14H21NO14S)n.H2O |
| Net Charge | 0 |
| Average Mass | 477.397 |
| Monoisotopic Mass | 477.07884 |
| SMILES | [H]O[C@@H]1O[C@H](CO)[C@H](OS(=O)(=O)O)[C@H](O[C@@H]2O[C@@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]2O)[C@H]1NC(C)=O |
| InChI | InChI=1S/C14H23NO15S/c1-3(17)15-5-10(9(30-31(24,25)26)4(2-16)27-13(5)23)28-14-8(20)6(18)7(19)11(29-14)12(21)22/h4-11,13-14,16,18-20,23H,2H2,1H3,(H,15,17)(H,21,22)(H,24,25,26)/t4-,5-,6+,7+,8-,9+,10-,11-,13-,14-/m1/s1 |
| InChIKey | AVJBPWGFOQAPRH-FWMKGIEWSA-N |
| Roles Classification |
|---|
| Applications: | hematologic agent Drug that acts on blood and blood-forming organs and those that affect the hemostatic system. anticoagulant An agent that prevents blood clotting. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dermatan sulfate (CHEBI:18376) has functional parent dermatan (CHEBI:4439) |
| dermatan sulfate (CHEBI:18376) has role anticoagulant (CHEBI:50249) |
| dermatan sulfate (CHEBI:18376) has role hematologic agent (CHEBI:50248) |
| dermatan sulfate (CHEBI:18376) is a mucopolysaccharide (CHEBI:37395) |
| dermatan sulfate (CHEBI:18376) is a sulfated glycosaminoglycan (CHEBI:35722) |
| dermatan sulfate (CHEBI:18376) is conjugate acid of dermatan sulfate polyanion (CHEBI:58465) |
| Incoming Relation(s) |
| dermatan sulfate proteoglycan (CHEBI:64602) has part dermatan sulfate (CHEBI:18376) |
| dermatan sulfate polyanion (CHEBI:58465) is conjugate base of dermatan sulfate (CHEBI:18376) |
| Synonyms | Source |
|---|---|
| Chondroitin sulfate B | KEGG COMPOUND |
| beta-Heparin | KEGG COMPOUND |
| Dermatan L-iduronate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00426 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Beilstein:8390617 | Beilstein |
| CAS:24967-94-0 | KEGG COMPOUND |
| CAS:24967-94-0 | ChemIDplus |