EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:58429 - α,α-trehalose 6-phosphate(2−)
| Formula | C12H21O14P |
| Net Charge | -2 |
| Average Mass | 420.260 |
| Monoisotopic Mass | 420.06799 |
| SMILES | O=P([O-])([O-])OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23O14P/c13-1-3-5(14)7(16)9(18)11(24-3)26-12-10(19)8(17)6(15)4(25-12)2-23-27(20,21)22/h3-19H,1-2H2,(H2,20,21,22)/p-2/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | LABSPYBHMPDTEL-LIZSDCNHSA-L |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Saccharomyces cerevisiae (ncbitaxon:4932) | - | PubMed (24678285) | Source: yeast.sf.net |
| Roles Classification |
|---|
| Biological Role: | Saccharomyces cerevisiae metabolite Any fungal metabolite produced during a metabolic reaction in Baker's yeast (Saccharomyces cerevisiae ). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α,α-trehalose 6-phosphate(2−) (CHEBI:58429) has functional parent α,α-trehalose (CHEBI:16551) |
| α,α-trehalose 6-phosphate(2−) (CHEBI:58429) has role Saccharomyces cerevisiae metabolite (CHEBI:75772) |
| α,α-trehalose 6-phosphate(2−) (CHEBI:58429) is a organophosphate oxoanion (CHEBI:58945) |
| α,α-trehalose 6-phosphate(2−) (CHEBI:58429) is conjugate base of α,α-trehalose 6-phosphate (CHEBI:18283) |
| Incoming Relation(s) |
| α,α-trehalose 6-phosphate (CHEBI:18283) is conjugate acid of α,α-trehalose 6-phosphate(2−) (CHEBI:58429) |
| IUPAC Name |
|---|
| α-D-glucopyranosyl 6-O-phosphonato-α-D-glucopyranoside |
| UniProt Name | Source |
|---|---|
| α,α-trehalose 6-phosphate | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3744918 | Beilstein |