EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H23O14P |
| Net Charge | 0 |
| Average Mass | 422.276 |
| Monoisotopic Mass | 422.08254 |
| SMILES | O=P(O)(O)OC[C@H]1O[C@H](O[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C12H23O14P/c13-1-3-5(14)7(16)9(18)11(24-3)26-12-10(19)8(17)6(15)4(25-12)2-23-27(20,21)22/h3-19H,1-2H2,(H2,20,21,22)/t3-,4-,5-,6-,7+,8+,9-,10-,11-,12-/m1/s1 |
| InChIKey | LABSPYBHMPDTEL-LIZSDCNHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Escherichia coli (ncbitaxon:562) | - | PubMed (21988831) |
| Roles Classification |
|---|
| Biological Role: | Escherichia coli metabolite Any bacterial metabolite produced during a metabolic reaction in Escherichia coli. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| α,α-trehalose 6-phosphate (CHEBI:18283) has functional parent α,α-trehalose (CHEBI:16551) |
| α,α-trehalose 6-phosphate (CHEBI:18283) has role Escherichia coli metabolite (CHEBI:76971) |
| α,α-trehalose 6-phosphate (CHEBI:18283) is a trehalose phosphate (CHEBI:27084) |
| α,α-trehalose 6-phosphate (CHEBI:18283) is conjugate acid of α,α-trehalose 6-phosphate(2−) (CHEBI:58429) |
| Incoming Relation(s) |
| α,α-trehalose 6-phosphate(2−) (CHEBI:58429) is conjugate base of α,α-trehalose 6-phosphate (CHEBI:18283) |
| IUPAC Name |
|---|
| α-D-glucopyranosyl 6-O-phosphono-α-D-glucopyranoside |
| Synonyms | Source |
|---|---|
| alpha,alpha'-Trehalose 6-phosphate | KEGG COMPOUND |
| Trehalose 6-phosphate | KEGG COMPOUND |
| α-D-glucopyranosyl α-D-glucopyranoside 6-(dihydrogen phosphate) | ChemIDplus |