EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C([O-])[C@@H]1CC(O)C[NH2+]1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3?,4-/m0/s1 |
| InChIKey | PMMYEEVYMWASQN-BKLSDQPFSA-N |
| Roles Classification |
|---|
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-L-proline zwitterion (CHEBI:58419) has role human metabolite (CHEBI:77746) |
| 4-hydroxy-L-proline zwitterion (CHEBI:58419) is a 4-hydroxyproline zwitterion (CHEBI:63137) |
| 4-hydroxy-L-proline zwitterion (CHEBI:58419) is tautomer of 4-hydroxy-L-proline (CHEBI:18240) |
| Incoming Relation(s) |
| 4-hydroxy-L-proline (CHEBI:18240) is tautomer of 4-hydroxy-L-proline zwitterion (CHEBI:58419) |
| IUPAC Name |
|---|
| (2S)-4-hydroxypyrrolidinium-2-carboxylate |
| UniProt Name | Source |
|---|---|
| 4-hydroxy-L-proline | UniProt |