EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18240 - 4-hydroxy-L-proline
| Formula | C5H9NO3 |
| Net Charge | 0 |
| Average Mass | 131.131 |
| Monoisotopic Mass | 131.05824 |
| SMILES | O=C(O)[C@@H]1CC(O)CN1 |
| InChI | InChI=1S/C5H9NO3/c7-3-1-4(5(8)9)6-2-3/h3-4,6-7H,1-2H2,(H,8,9)/t3?,4-/m0/s1 |
| InChIKey | PMMYEEVYMWASQN-BKLSDQPFSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | human metabolite Any mammalian metabolite produced during a metabolic reaction in humans (Homo sapiens). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-hydroxy-L-proline (CHEBI:18240) is a L-proline derivative (CHEBI:84186) |
| 4-hydroxy-L-proline (CHEBI:18240) is a 4-hydroxyproline (CHEBI:20392) |
| 4-hydroxy-L-proline (CHEBI:18240) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| 4-hydroxy-L-proline (CHEBI:18240) is conjugate acid of 4-hydroxy-L-prolinate (CHEBI:62981) |
| 4-hydroxy-L-proline (CHEBI:18240) is enantiomer of 4-hydroxy-D-proline (CHEBI:144637) |
| 4-hydroxy-L-proline (CHEBI:18240) is tautomer of 4-hydroxy-L-proline zwitterion (CHEBI:58419) |
| Incoming Relation(s) |
| 4-hydroxy-L-prolinate (CHEBI:62981) is conjugate base of 4-hydroxy-L-proline (CHEBI:18240) |
| 4-hydroxy-D-proline (CHEBI:144637) is enantiomer of 4-hydroxy-L-proline (CHEBI:18240) |
| 4-hydroxy-L-proline residue (CHEBI:90860) is substituent group from 4-hydroxy-L-proline (CHEBI:18240) |
| 4-hydroxy-L-proline zwitterion (CHEBI:58419) is tautomer of 4-hydroxy-L-proline (CHEBI:18240) |
| IUPAC Name |
|---|
| 4-hydroxy-L-proline |
| Synonyms | Source |
|---|---|
| 4-Hydroxy-L-proline | KEGG COMPOUND |
| L-Hydroxyproline | KEGG COMPOUND |
| (2S)-4-hydroxypyrrolidine-2-carboxylic acid | IUPAC |
| hydroxy-L-proline | ChEBI |
| cis-4-Hydroxy-L-Proline | HMDB |
| Manual Xrefs | Databases |
|---|---|
| C01015 | KEGG COMPOUND |
| 4-hydroxy-L-proline | Wikipedia |
| C00001370 | KNApSAcK |
| HMDB0006055 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:81441 | Reaxys |
| CAS:51-35-4 | KEGG COMPOUND |