EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | (C12H15NO19S3)n.C6H14NO5 |
| Net Charge | -3 |
| Average Mass | 753.621 |
| Monoisotopic Mass | 753.02888 |
| SMILES | [NH3+][C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](OS(=O)(=O)[O-])[C@H](O[C@H]3[C@H](O)[C@@H](NS(=O)(=O)[O-])[C@@H](O)O[C@@H]3COS(=O)(=O)[O-])O[C@H]2C(=O)[O-])O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H32N2O24S3/c19-5-8(23)7(22)3(1-21)40-17(5)42-12-10(25)13(44-47(35,36)37)18(43-14(12)15(26)27)41-11-4(2-38-46(32,33)34)39-16(28)6(9(11)24)20-45(29,30)31/h3-14,16-18,20-25,28H,1-2,19H2,(H,26,27)(H,29,30,31)(H,32,33,34)(H,35,36,37)/p-3/t3-,4-,5-,6-,7-,8-,9-,10+,11-,12+,13-,14-,16+,17-,18-/m1/s1 |
| InChIKey | JAXHHZAWQAGVNS-BCMGMHEASA-K |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heparan sulfate α-D-glucosaminide polyanion (CHEBI:58388) is a carbohydrate acid derivative anion (CHEBI:63551) |
| heparan sulfate α-D-glucosaminide polyanion (CHEBI:58388) is a ionic polymer (CHEBI:60164) |
| heparan sulfate α-D-glucosaminide polyanion (CHEBI:58388) is a organic sulfamate oxoanion (CHEBI:61660) |
| heparan sulfate α-D-glucosaminide polyanion (CHEBI:58388) is conjugate base of heparan sulfate α-D-glucosaminide (CHEBI:18137) |
| Incoming Relation(s) |
| heparan sulfate α-D-glucosaminide (CHEBI:18137) is conjugate acid of heparan sulfate α-D-glucosaminide polyanion (CHEBI:58388) |
| UniProt Name | Source |
|---|---|
| heparan sulfate α-D-glucosaminide | UniProt |