EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:18137 - heparan sulfate α-D-glucosaminide
| Formula | (C12H19NO19S3)n.C6H13NO5 |
| Net Charge | 0 |
| Average Mass | 756.645 |
| Monoisotopic Mass | 756.05071 |
| SMILES | N[C@H]1[C@@H](O[C@H]2[C@H](O)[C@@H](OS(=O)(=O)O)[C@H](O[C@H]3[C@H](O)[C@@H](NS(=O)(=O)O)[C@@H](O)O[C@@H]3COS(=O)(=O)O)O[C@H]2C(=O)O)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C18H32N2O24S3/c19-5-8(23)7(22)3(1-21)40-17(5)42-12-10(25)13(44-47(35,36)37)18(43-14(12)15(26)27)41-11-4(2-38-46(32,33)34)39-16(28)6(9(11)24)20-45(29,30)31/h3-14,16-18,20-25,28H,1-2,19H2,(H,26,27)(H,29,30,31)(H,32,33,34)(H,35,36,37)/t3-,4-,5-,6-,7-,8-,9-,10+,11-,12+,13-,14-,16+,17-,18-/m1/s1 |
| InChIKey | JAXHHZAWQAGVNS-BCMGMHEASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | - | PubMed (19425150) | Source: BioModels - MODEL1507180067 |
| Roles Classification |
|---|
| Biological Roles: | mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). mouse metabolite Any mammalian metabolite produced during a metabolic reaction in a mouse (Mus musculus). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| heparan sulfate α-D-glucosaminide (CHEBI:18137) has role mouse metabolite (CHEBI:75771) |
| heparan sulfate α-D-glucosaminide (CHEBI:18137) is a heparan sulfates (CHEBI:35721) |
| heparan sulfate α-D-glucosaminide (CHEBI:18137) is a heparan α-D-glucosaminide (CHEBI:24495) |
| heparan sulfate α-D-glucosaminide (CHEBI:18137) is conjugate acid of heparan sulfate α-D-glucosaminide polyanion (CHEBI:58388) |
| Incoming Relation(s) |
| heparan sulfate α-D-glucosaminide polyanion (CHEBI:58388) is conjugate base of heparan sulfate α-D-glucosaminide (CHEBI:18137) |
| Synonym | Source |
|---|---|
| Heparan sulfate alpha-D-glucosaminide | KEGG COMPOUND |