EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H22N4O4 |
| Net Charge | 0 |
| Average Mass | 298.343 |
| Monoisotopic Mass | 298.16411 |
| SMILES | C[N+](C)(C)[C@@H](CCc1ncc(C[C@H]([NH3+])C(=O)[O-])n1)C(=O)[O-] |
| InChI | InChI=1S/C13H22N4O4/c1-17(2,3)10(13(20)21)4-5-11-15-7-8(16-11)6-9(14)12(18)19/h7,9-10H,4-6,14H2,1-3H3,(H2-,15,16,18,19,20,21)/t9-,10-/m0/s1 |
| InChIKey | CBQVLMCHMFGPMX-UWVGGRQHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| diphthinate (CHEBI:58361) is a amino-acid zwitterion (CHEBI:35238) |
| diphthinate (CHEBI:58361) is conjugate base of diphthine (CHEBI:18054) |
| Incoming Relation(s) |
| diphthine (CHEBI:18054) is conjugate acid of diphthinate (CHEBI:58361) |
| IUPAC Name |
|---|
| (2S)-4-{4-[(2S)-2-azaniumyl-2-carboxylatoethyl]-1H-imidazol-2-yl}-2-(trimethylazaniumyl)butanoate |